C14H17N3O3 — CID 66238418
4-amino-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxolane-3-carboxamide (PubChem CID 66238418) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-amino-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxolane-3-carboxamide.
| Compound Name | 4-amino-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66238418 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-amino-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxolane-3-carboxamide |
| SMILES | NC1COCC1C(=O)Nc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H17N3O3/c15-11-7-20-6-10(11)14(19)16-9-2-3-12-8(5-9)1-4-13(18)17-12/h2-3,5,10-11H,1,4,6-7,15H2,(H,16,19)(H,17,18) |
| InChIKey | QEWXQVVGFJGONU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |