About N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide
N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide (PubChem CID 6623870) has the molecular formula C13H11N3O2
and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide |
| PubChem CID | 6623870 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(NCc1cn2ccccc2n1)c1ccco1 |
| InChI | InChI=1S/C13H11N3O2/c17-13(11-4-3-7-18-11)14-8-10-9-16-6-2-1-5-12(16)15-10/h1-7,9H,8H2,(H,14,17) |
| InChIKey | NWALHQRPVQYKKS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide?
The IUPAC name of N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide (CID 6623870) is N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide.
What is the SMILES notation for N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide?
The canonical SMILES for N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide is O=C(NCc1cn2ccccc2n1)c1ccco1.
What is the InChIKey of N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide?
The InChIKey is NWALHQRPVQYKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2/c17-13(11-4-3-7-18-11)14-8-10-9-16-6-2-1-5-12(16)15-10/h1-7,9H,8H2,(H,14,17).
What are the key properties of N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide?
N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide has a molecular weight of 241.25 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(imidazo[1,2-a]pyridin-2-ylmethyl)furan-2-carboxamide is sourced from PubChem (CID 6623870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).