About 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid
4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid (PubChem CID 66238707) has the molecular formula C11H10N4O6
and a molecular weight of 294.22 g/mol. Its IUPAC name is 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid |
| PubChem CID | 66238707 |
| Molecular Formula | C11H10N4O6 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1COCC1Nc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C11H10N4O6/c16-11(17)5-3-20-4-7(5)12-6-1-2-8(15(18)19)10-9(6)13-21-14-10/h1-2,5,7,12H,3-4H2,(H,16,17) |
| InChIKey | ZGZLCDWAKWLDAK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid?
The IUPAC name of 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid (CID 66238707) is 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid.
What is the SMILES notation for 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid?
The canonical SMILES for 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid is O=C(O)C1COCC1Nc1ccc([N+](=O)[O-])c2nonc12.
What is the InChIKey of 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid?
The InChIKey is ZGZLCDWAKWLDAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O6/c16-11(17)5-3-20-4-7(5)12-6-1-2-8(15(18)19)10-9(6)13-21-14-10/h1-2,5,7,12H,3-4H2,(H,16,17).
What are the key properties of 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid?
4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid has a molecular weight of 294.22 g/mol, XLogP of 0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxolane-3-carboxylic acid is sourced from PubChem (CID 66238707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).