C11H14ClN3O4S — CID 66239243
4-amino-N-(2-chloro-5-sulfamoylphenyl)oxolane-3-carboxamide (PubChem CID 66239243) has the molecular formula C11H14ClN3O4S and a molecular weight of 319.77 g/mol. Its IUPAC name is 4-amino-N-(2-chloro-5-sulfamoylphenyl)oxolane-3-carboxamide.
| Compound Name | 4-amino-N-(2-chloro-5-sulfamoylphenyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66239243 |
| Molecular Formula | C11H14ClN3O4S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-amino-N-(2-chloro-5-sulfamoylphenyl)oxolane-3-carboxamide |
| SMILES | NC1COCC1C(=O)Nc1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C11H14ClN3O4S/c12-8-2-1-6(20(14,17)18)3-10(8)15-11(16)7-4-19-5-9(7)13/h1-3,7,9H,4-5,13H2,(H,15,16)(H2,14,17,18) |
| InChIKey | WDOFFLLRXDXEQN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |