About 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine
6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 6623953) has the molecular formula C17H13N5S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine.
Molecular Properties
| Compound Name | 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine |
| PubChem CID | 6623953 |
| Molecular Formula | C17H13N5S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | c1ccc(CSc2ccc3nnc(-c4ccccn4)n3n2)cc1 |
| InChI | InChI=1S/C17H13N5S/c1-2-6-13(7-3-1)12-23-16-10-9-15-19-20-17(22(15)21-16)14-8-4-5-11-18-14/h1-11H,12H2 |
| InChIKey | IVCYFLNNBRMHQJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine?
The IUPAC name of 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine (CID 6623953) is 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine.
What is the SMILES notation for 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine?
The canonical SMILES for 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine is c1ccc(CSc2ccc3nnc(-c4ccccn4)n3n2)cc1.
What is the InChIKey of 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine?
The InChIKey is IVCYFLNNBRMHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5S/c1-2-6-13(7-3-1)12-23-16-10-9-15-19-20-17(22(15)21-16)14-8-4-5-11-18-14/h1-11H,12H2.
What are the key properties of 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine?
6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine has a molecular weight of 319.39 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylsulfanyl-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine is sourced from PubChem (CID 6623953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).