C29H36N4O — CID 6624008
4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide (PubChem CID 6624008) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is 4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 6624008 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide |
| SMILES | CC1CCc2c(cc(-c3ccccc3)n2-c2ccc(C(=O)NCCN3CCN(C)CC3)cc2)C1 |
| InChI | InChI=1S/C29H36N4O/c1-22-8-13-27-25(20-22)21-28(23-6-4-3-5-7-23)33(27)26-11-9-24(10-12-26)29(34)30-14-15-32-18-16-31(2)17-19-32/h3-7,9-12,21-22H,8,13-20H2,1-2H3,(H,30,34) |
| InChIKey | CETSUNMEKRRADT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|