About 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine
4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine (PubChem CID 66240484) has the molecular formula C10H11N5O2
and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine.
Molecular Properties
| Compound Name | 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
| PubChem CID | 66240484 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
| SMILES | NC1COCC1c1nc(-c2ncccn2)no1 |
| InChI | InChI=1S/C10H11N5O2/c11-7-5-16-4-6(7)10-14-9(15-17-10)8-12-2-1-3-13-8/h1-3,6-7H,4-5,11H2 |
| InChIKey | DFFLELYEEQWTSQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine?
The IUPAC name of 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine (CID 66240484) is 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine.
What is the SMILES notation for 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine?
The canonical SMILES for 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine is NC1COCC1c1nc(-c2ncccn2)no1.
What is the InChIKey of 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine?
The InChIKey is DFFLELYEEQWTSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O2/c11-7-5-16-4-6(7)10-14-9(15-17-10)8-12-2-1-3-13-8/h1-3,6-7H,4-5,11H2.
What are the key properties of 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine?
4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine has a molecular weight of 233.23 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine is sourced from PubChem (CID 66240484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).