C13H17NO5S — CID 66240671
4-[(2,5-dimethylphenyl)sulfonylamino]oxolane-3-carboxylic acid (PubChem CID 66240671) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)sulfonylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(2,5-dimethylphenyl)sulfonylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66240671 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)sulfonylamino]oxolane-3-carboxylic acid |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NC2COCC2C(=O)O)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-8-3-4-9(2)12(5-8)20(17,18)14-11-7-19-6-10(11)13(15)16/h3-5,10-11,14H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | ULHXRBDJKGENDF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |