C9H15N3O2 — CID 66240879
4-(3-propyl-1,2,4-oxadiazol-5-yl)oxolan-3-amine (PubChem CID 66240879) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-(3-propyl-1,2,4-oxadiazol-5-yl)oxolan-3-amine.
| Compound Name | 4-(3-propyl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 66240879 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-(3-propyl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
| SMILES | CCCc1noc(C2COCC2N)n1 |
| InChI | InChI=1S/C9H15N3O2/c1-2-3-8-11-9(14-12-8)6-4-13-5-7(6)10/h6-7H,2-5,10H2,1H3 |
| InChIKey | AOCJKTXTYKQSKC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |