About 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine
5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine (PubChem CID 66241827) has the molecular formula C13H18N2S
and a molecular weight of 234.37 g/mol. Its IUPAC name is 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine |
| PubChem CID | 66241827 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine |
| SMILES | CC1CNC(c2ccc3c(c2)CCN3C)S1 |
| InChI | InChI=1S/C13H18N2S/c1-9-8-14-13(16-9)11-3-4-12-10(7-11)5-6-15(12)2/h3-4,7,9,13-14H,5-6,8H2,1-2H3 |
| InChIKey | PHJIECUTIODAOH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine?
The IUPAC name of 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine (CID 66241827) is 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine.
What is the SMILES notation for 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine?
The canonical SMILES for 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine is CC1CNC(c2ccc3c(c2)CCN3C)S1.
What is the InChIKey of 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine?
The InChIKey is PHJIECUTIODAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2S/c1-9-8-14-13(16-9)11-3-4-12-10(7-11)5-6-15(12)2/h3-4,7,9,13-14H,5-6,8H2,1-2H3.
What are the key properties of 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine?
5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine has a molecular weight of 234.37 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine is sourced from PubChem (CID 66241827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).