C13H18N4O3 — CID 66241907
5-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 66241907) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66241907 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC1(C)C2CNCC2CN1C(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H18N4O3/c1-13(2)9-5-14-3-7(9)6-17(13)11(19)8-4-15-12(20)16-10(8)18/h4,7,9,14H,3,5-6H2,1-2H3,(H2,15,16,18,20) |
| InChIKey | FOBKBGBWYNODGS-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |