C13H17F3N4 — CID 66241959
4,4-dimethyl-5-[4-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66241959) has the molecular formula C13H17F3N4 and a molecular weight of 286.30 g/mol. Its IUPAC name is 4,4-dimethyl-5-[4-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-[4-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66241959 |
| Molecular Formula | C13H17F3N4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4,4-dimethyl-5-[4-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1(C)C2CNCC2CN1c1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H17F3N4/c1-12(2)9-6-17-5-8(9)7-20(12)11-18-4-3-10(19-11)13(14,15)16/h3-4,8-9,17H,5-7H2,1-2H3 |
| InChIKey | XWKJDCLFZNEKIS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |