About ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate
ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate (PubChem CID 66242634) has the molecular formula C13H17NO6S
and a molecular weight of 315.35 g/mol. Its IUPAC name is ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate |
| PubChem CID | 66242634 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate |
| SMILES | CCOC(=O)c1c(N)c(CS(C)(=O)=O)cc2c1OCCO2 |
| InChI | InChI=1S/C13H17NO6S/c1-3-18-13(15)10-11(14)8(7-21(2,16)17)6-9-12(10)20-5-4-19-9/h6H,3-5,7,14H2,1-2H3 |
| InChIKey | MJRVRLHMJINMRF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate?
The IUPAC name of ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate (CID 66242634) is ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate.
What is the SMILES notation for ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate?
The canonical SMILES for ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate is CCOC(=O)c1c(N)c(CS(C)(=O)=O)cc2c1OCCO2.
What is the InChIKey of ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate?
The InChIKey is MJRVRLHMJINMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO6S/c1-3-18-13(15)10-11(14)8(7-21(2,16)17)6-9-12(10)20-5-4-19-9/h6H,3-5,7,14H2,1-2H3.
What are the key properties of ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate?
ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate has a molecular weight of 315.35 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-amino-7-(methylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxylate is sourced from PubChem (CID 66242634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).