About 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine
2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine (PubChem CID 66242662) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine |
| PubChem CID | 66242662 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine |
| SMILES | CC1CNC(C2CC=CCC2)S1 |
| InChI | InChI=1S/C10H17NS/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-3,8-11H,4-7H2,1H3 |
| InChIKey | MZSUQYFYHJZNHS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine?
The IUPAC name of 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine (CID 66242662) is 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine.
What is the SMILES notation for 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine?
The canonical SMILES for 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine is CC1CNC(C2CC=CCC2)S1.
What is the InChIKey of 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine?
The InChIKey is MZSUQYFYHJZNHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-3,8-11H,4-7H2,1H3.
What are the key properties of 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine?
2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine has a molecular weight of 183.32 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohex-3-en-1-yl-5-methyl-1,3-thiazolidine is sourced from PubChem (CID 66242662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).