About 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine
5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine (PubChem CID 66242874) has the molecular formula C13H13F6NS
and a molecular weight of 329.31 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine |
| PubChem CID | 66242874 |
| Molecular Formula | C13H13F6NS |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine |
| SMILES | CC1CNC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CS1 |
| InChI | InChI=1S/C13H13F6NS/c1-7-5-20-11(6-21-7)8-2-9(12(14,15)16)4-10(3-8)13(17,18)19/h2-4,7,11,20H,5-6H2,1H3 |
| InChIKey | IDRXQFYGPWIMOP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine (CID 66242874) is 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine is CC1CNC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CS1.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine?
The InChIKey is IDRXQFYGPWIMOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F6NS/c1-7-5-20-11(6-21-7)8-2-9(12(14,15)16)4-10(3-8)13(17,18)19/h2-4,7,11,20H,5-6H2,1H3.
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine?
5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine has a molecular weight of 329.31 g/mol, XLogP of 4.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]-2-methylthiomorpholine is sourced from PubChem (CID 66242874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).