C13H17N5 — CID 66243188
5-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrazine-2-carbonitrile (PubChem CID 66243188) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 5-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrazine-2-carbonitrile.
| Compound Name | 5-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 66243188 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 5-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrazine-2-carbonitrile |
| SMILES | CC1(C)C2CNCC2CN1c1cnc(C#N)cn1 |
| InChI | InChI=1S/C13H17N5/c1-13(2)11-6-15-4-9(11)8-18(13)12-7-16-10(3-14)5-17-12/h5,7,9,11,15H,4,6,8H2,1-2H3 |
| InChIKey | UWYKKGKFXURIHK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |