C17H22BrN3 — CID 66243530
5-bromo-3-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-1H-indole (PubChem CID 66243530) has the molecular formula C17H22BrN3 and a molecular weight of 348.29 g/mol. Its IUPAC name is 5-bromo-3-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-1H-indole.
| Compound Name | 5-bromo-3-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 66243530 |
| Molecular Formula | C17H22BrN3 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-bromo-3-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-1H-indole |
| SMILES | CC1(C)C2CNCC2CN1Cc1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C17H22BrN3/c1-17(2)15-8-19-6-12(15)10-21(17)9-11-7-20-16-4-3-13(18)5-14(11)16/h3-5,7,12,15,19-20H,6,8-10H2,1-2H3 |
| InChIKey | GTEXZMCZWWHZOJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |