C9H15F3N2O2S — CID 66243559
4,4-dimethyl-5-(trifluoromethylsulfonyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66243559) has the molecular formula C9H15F3N2O2S and a molecular weight of 272.29 g/mol. Its IUPAC name is 4,4-dimethyl-5-(trifluoromethylsulfonyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(trifluoromethylsulfonyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66243559 |
| Molecular Formula | C9H15F3N2O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4,4-dimethyl-5-(trifluoromethylsulfonyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1(C)C2CNCC2CN1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O2S/c1-8(2)7-4-13-3-6(7)5-14(8)17(15,16)9(10,11)12/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | LIIJTAKMYVZHJI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |