C14H21N3 — CID 66243738
4,4-dimethyl-5-(pyridin-4-ylmethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66243738) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4,4-dimethyl-5-(pyridin-4-ylmethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(pyridin-4-ylmethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66243738 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4,4-dimethyl-5-(pyridin-4-ylmethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1(C)C2CNCC2CN1Cc1ccncc1 |
| InChI | InChI=1S/C14H21N3/c1-14(2)13-8-16-7-12(13)10-17(14)9-11-3-5-15-6-4-11/h3-6,12-13,16H,7-10H2,1-2H3 |
| InChIKey | IZWWYSHCOAYUPP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |