C9H16F2N2O2S — CID 66243986
5-(difluoromethylsulfonyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66243986) has the molecular formula C9H16F2N2O2S and a molecular weight of 254.30 g/mol. Its IUPAC name is 5-(difluoromethylsulfonyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(difluoromethylsulfonyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66243986 |
| Molecular Formula | C9H16F2N2O2S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-(difluoromethylsulfonyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1(C)C2CNCC2CN1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C9H16F2N2O2S/c1-9(2)7-4-12-3-6(7)5-13(9)16(14,15)8(10)11/h6-8,12H,3-5H2,1-2H3 |
| InChIKey | CRBXUORDIXMPJA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |