C12H20N4O2S — CID 66244191
4,4-dimethyl-5-(1-methylpyrazol-4-yl)sulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66244191) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 4,4-dimethyl-5-(1-methylpyrazol-4-yl)sulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(1-methylpyrazol-4-yl)sulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66244191 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4,4-dimethyl-5-(1-methylpyrazol-4-yl)sulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cn1cc(S(=O)(=O)N2CC3CNCC3C2(C)C)cn1 |
| InChI | InChI=1S/C12H20N4O2S/c1-12(2)11-6-13-4-9(11)7-16(12)19(17,18)10-5-14-15(3)8-10/h5,8-9,11,13H,4,6-7H2,1-3H3 |
| InChIKey | GHUGPEWVINHILR-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |