C16H21N3OS — CID 66244635
4-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-2-thiophen-2-yl-1,3-oxazole (PubChem CID 66244635) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 66244635 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-2-thiophen-2-yl-1,3-oxazole |
| SMILES | CC1(C)C2CNCC2CN1Cc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C16H21N3OS/c1-16(2)13-7-17-6-11(13)8-19(16)9-12-10-20-15(18-12)14-4-3-5-21-14/h3-5,10-11,13,17H,6-9H2,1-2H3 |
| InChIKey | HXMBKNSKSMJBIH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |