C12H18N2O — CID 66244684
N-[1-(4-methoxyphenyl)ethyl]azetidin-3-amine (PubChem CID 66244684) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)ethyl]azetidin-3-amine.
| Compound Name | N-[1-(4-methoxyphenyl)ethyl]azetidin-3-amine |
|---|---|
| PubChem CID | 66244684 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-[1-(4-methoxyphenyl)ethyl]azetidin-3-amine |
| SMILES | COc1ccc(C(C)NC2CNC2)cc1 |
| InChI | InChI=1S/C12H18N2O/c1-9(14-11-7-13-8-11)10-3-5-12(15-2)6-4-10/h3-6,9,11,13-14H,7-8H2,1-2H3 |
| InChIKey | VGVZSQPPWOMPTQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |