C16H22F2N2 — CID 66244785
5-[1-(2,5-difluorophenyl)ethyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66244785) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is 5-[1-(2,5-difluorophenyl)ethyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[1-(2,5-difluorophenyl)ethyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66244785 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5-[1-(2,5-difluorophenyl)ethyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(c1cc(F)ccc1F)N1CC2CNCC2C1(C)C |
| InChI | InChI=1S/C16H22F2N2/c1-10(13-6-12(17)4-5-15(13)18)20-9-11-7-19-8-14(11)16(20,2)3/h4-6,10-11,14,19H,7-9H2,1-3H3 |
| InChIKey | SWSSVOAXZGORMS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |