C15H21FN2O2S — CID 66244825
5-[(4-fluorophenyl)methylsulfonyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66244825) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methylsulfonyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[(4-fluorophenyl)methylsulfonyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66244825 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 5-[(4-fluorophenyl)methylsulfonyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1(C)C2CNCC2CN1S(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O2S/c1-15(2)14-8-17-7-12(14)9-18(15)21(19,20)10-11-3-5-13(16)6-4-11/h3-6,12,14,17H,7-10H2,1-2H3 |
| InChIKey | TVXMNUKCZGRVSQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |