C15H20N4OS — CID 66244840
7-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 66244840) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 7-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 66244840 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 7-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CC1(C)C2CNCC2CN1Cc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C15H20N4OS/c1-15(2)12-7-16-6-10(12)8-18(15)9-11-5-13(20)19-3-4-21-14(19)17-11/h3-5,10,12,16H,6-9H2,1-2H3 |
| InChIKey | LKZYXIUDIMXYHR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |