C14H23N3O2 — CID 66244849
1-[2-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)acetyl]pyrrolidin-2-one (PubChem CID 66244849) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-[2-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)acetyl]pyrrolidin-2-one.
| Compound Name | 1-[2-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)acetyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 66244849 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-[2-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)acetyl]pyrrolidin-2-one |
| SMILES | CC1(C)C2CNCC2CN1CC(=O)N1CCCC1=O |
| InChI | InChI=1S/C14H23N3O2/c1-14(2)11-7-15-6-10(11)8-16(14)9-13(19)17-5-3-4-12(17)18/h10-11,15H,3-9H2,1-2H3 |
| InChIKey | KSTSOYWNXNRXQG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |