C15H23N3O2S — CID 66244861
4-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-methylbenzenesulfonamide (PubChem CID 66244861) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 66244861 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N2CC3CNCC3C2(C)C)cc1 |
| InChI | InChI=1S/C15H23N3O2S/c1-15(2)14-9-17-8-11(14)10-18(15)12-4-6-13(7-5-12)21(19,20)16-3/h4-7,11,14,16-17H,8-10H2,1-3H3 |
| InChIKey | LECSRMZZAXXEEH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |