About 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid
4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid (PubChem CID 66244918) has the molecular formula C9H14F3NO3
and a molecular weight of 241.21 g/mol. Its IUPAC name is 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid |
| PubChem CID | 66244918 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid |
| SMILES | CCN(CC(F)(F)F)C1COCC1C(=O)O |
| InChI | InChI=1S/C9H14F3NO3/c1-2-13(5-9(10,11)12)7-4-16-3-6(7)8(14)15/h6-7H,2-5H2,1H3,(H,14,15) |
| InChIKey | VWZOXPPAKMCLAH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid?
The IUPAC name of 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid (CID 66244918) is 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid.
What is the SMILES notation for 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid?
The canonical SMILES for 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid is CCN(CC(F)(F)F)C1COCC1C(=O)O.
What is the InChIKey of 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid?
The InChIKey is VWZOXPPAKMCLAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO3/c1-2-13(5-9(10,11)12)7-4-16-3-6(7)8(14)15/h6-7H,2-5H2,1H3,(H,14,15).
What are the key properties of 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid?
4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid has a molecular weight of 241.21 g/mol, XLogP of 0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[ethyl(2,2,2-trifluoroethyl)amino]oxolane-3-carboxylic acid is sourced from PubChem (CID 66244918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).