C11H22N2OS — CID 66245775
N-methyl-4-(1,4-thiazepan-4-ylmethyl)oxolan-3-amine (PubChem CID 66245775) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is N-methyl-4-(1,4-thiazepan-4-ylmethyl)oxolan-3-amine.
| Compound Name | N-methyl-4-(1,4-thiazepan-4-ylmethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 66245775 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-methyl-4-(1,4-thiazepan-4-ylmethyl)oxolan-3-amine |
| SMILES | CNC1COCC1CN1CCCSCC1 |
| InChI | InChI=1S/C11H22N2OS/c1-12-11-9-14-8-10(11)7-13-3-2-5-15-6-4-13/h10-12H,2-9H2,1H3 |
| InChIKey | IFAAHECMZWHTDE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |