C25H32ClN3O2 — CID 6624625
4-chloro-2-[4-(4-ethoxyphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol (PubChem CID 6624625) has the molecular formula C25H32ClN3O2 and a molecular weight of 442.00 g/mol. Its IUPAC name is 4-chloro-2-[4-(4-ethoxyphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol.
| Compound Name | 4-chloro-2-[4-(4-ethoxyphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 6624625 |
| Molecular Formula | C25H32ClN3O2 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 4-chloro-2-[4-(4-ethoxyphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
| SMILES | CCOc1ccc(C2=NC3(CCN(C(C)C)CC3)NC(c3cc(Cl)ccc3O)C2)cc1 |
| InChI | InChI=1S/C25H32ClN3O2/c1-4-31-20-8-5-18(6-9-20)22-16-23(21-15-19(26)7-10-24(21)30)28-25(27-22)11-13-29(14-12-25)17(2)3/h5-10,15,17,23,28,30H,4,11-14,16H2,1-3H3 |
| InChIKey | AJKMRFMDBKNIBU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|