About N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine
N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine (PubChem CID 66247365) has the molecular formula C11H22N2O3S
and a molecular weight of 262.37 g/mol. Its IUPAC name is N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine.
Molecular Properties
| Compound Name | N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine |
| PubChem CID | 66247365 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine |
| SMILES | CNC1COCC1CNC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-11(3-4-17(14,15)8-11)13-5-9-6-16-7-10(9)12-2/h9-10,12-13H,3-8H2,1-2H3 |
| InChIKey | NOBYQJCLMZZGSU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine?
The IUPAC name of N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine (CID 66247365) is N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine.
What is the SMILES notation for N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine?
The canonical SMILES for N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine is CNC1COCC1CNC1(C)CCS(=O)(=O)C1.
What is the InChIKey of N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine?
The InChIKey is NOBYQJCLMZZGSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3S/c1-11(3-4-17(14,15)8-11)13-5-9-6-16-7-10(9)12-2/h9-10,12-13H,3-8H2,1-2H3.
What are the key properties of N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine?
N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine has a molecular weight of 262.37 g/mol, XLogP of -0.61, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]oxolan-3-amine is sourced from PubChem (CID 66247365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).