About N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide
N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 6624797) has the molecular formula C8H17NO4S2
and a molecular weight of 255.36 g/mol. Its IUPAC name is N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide |
| PubChem CID | 6624797 |
| Molecular Formula | C8H17NO4S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CC(C)CNS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H17NO4S2/c1-7(2)5-9-15(12,13)8-3-4-14(10,11)6-8/h7-9H,3-6H2,1-2H3 |
| InChIKey | WJBVSHWHCVOBJJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide?
The IUPAC name of N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide (CID 6624797) is N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide.
What is the SMILES notation for N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide?
The canonical SMILES for N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide is CC(C)CNS(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide?
The InChIKey is WJBVSHWHCVOBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4S2/c1-7(2)5-9-15(12,13)8-3-4-14(10,11)6-8/h7-9H,3-6H2,1-2H3.
What are the key properties of N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide?
N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide has a molecular weight of 255.36 g/mol, XLogP of -0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)-1,1-dioxothiolane-3-sulfonamide is sourced from PubChem (CID 6624797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).