About 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid
4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid (PubChem CID 66248351) has the molecular formula C10H17N3O5
and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid |
| PubChem CID | 66248351 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid |
| SMILES | CC1(C(=O)O)COCC1NC(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C10H17N3O5/c1-10(9(16)17)4-18-3-6(10)13-8(15)5(11)2-7(12)14/h5-6H,2-4,11H2,1H3,(H2,12,14)(H,13,15)(H,16,17) |
| InChIKey | NBRCYVIBSLRUBC-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid?
The IUPAC name of 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid (CID 66248351) is 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid.
What is the SMILES notation for 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid?
The canonical SMILES for 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid is CC1(C(=O)O)COCC1NC(=O)C(N)CC(N)=O.
What is the InChIKey of 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid?
The InChIKey is NBRCYVIBSLRUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O5/c1-10(9(16)17)4-18-3-6(10)13-8(15)5(11)2-7(12)14/h5-6H,2-4,11H2,1H3,(H2,12,14)(H,13,15)(H,16,17).
What are the key properties of 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid?
4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid has a molecular weight of 259.26 g/mol, XLogP of -2.20, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-diamino-4-oxobutanoyl)amino]-3-methyloxolane-3-carboxylic acid is sourced from PubChem (CID 66248351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).