C11H17F3N2O5 — CID 66249392
3-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]oxolane-3-carboxylic acid (PubChem CID 66249392) has the molecular formula C11H17F3N2O5 and a molecular weight of 314.26 g/mol. Its IUPAC name is 3-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]oxolane-3-carboxylic acid.
| Compound Name | 3-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66249392 |
| Molecular Formula | C11H17F3N2O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]oxolane-3-carboxylic acid |
| SMILES | CC1(C(=O)O)COCC1NC(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O5/c1-10(8(17)18)5-21-4-7(10)16-9(19)15-2-3-20-6-11(12,13)14/h7H,2-6H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | VULSENOVDNBPRP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|