C16H24N2O2 — CID 66249430
4-amino-N,3-dimethyl-N-(3-phenylpropyl)oxolane-3-carboxamide (PubChem CID 66249430) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-amino-N,3-dimethyl-N-(3-phenylpropyl)oxolane-3-carboxamide.
| Compound Name | 4-amino-N,3-dimethyl-N-(3-phenylpropyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66249430 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-amino-N,3-dimethyl-N-(3-phenylpropyl)oxolane-3-carboxamide |
| SMILES | CN(CCCc1ccccc1)C(=O)C1(C)COCC1N |
| InChI | InChI=1S/C16H24N2O2/c1-16(12-20-11-14(16)17)15(19)18(2)10-6-9-13-7-4-3-5-8-13/h3-5,7-8,14H,6,9-12,17H2,1-2H3 |
| InChIKey | RDHVXKQSWKXXLK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |