C14H19NO5S — CID 66250693
4-(2-ethylsulfonylanilino)-3-methyloxolane-3-carboxylic acid (PubChem CID 66250693) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-(2-ethylsulfonylanilino)-3-methyloxolane-3-carboxylic acid.
| Compound Name | 4-(2-ethylsulfonylanilino)-3-methyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66250693 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-(2-ethylsulfonylanilino)-3-methyloxolane-3-carboxylic acid |
| SMILES | CCS(=O)(=O)c1ccccc1NC1COCC1(C)C(=O)O |
| InChI | InChI=1S/C14H19NO5S/c1-3-21(18,19)11-7-5-4-6-10(11)15-12-8-20-9-14(12,2)13(16)17/h4-7,12,15H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | MUNGRQFXEJCBDL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |