About [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate
[3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate (PubChem CID 6625176) has the molecular formula C21H18FN3O3
and a molecular weight of 379.39 g/mol. Its IUPAC name is [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate.
Molecular Properties
| Compound Name | [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate |
| PubChem CID | 6625176 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate |
| SMILES | Cc1ccc(C)c(NC(=O)c2nccnc2COC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H18FN3O3/c1-13-6-7-14(2)17(10-13)25-20(26)19-18(23-8-9-24-19)12-28-21(27)15-4-3-5-16(22)11-15/h3-11H,12H2,1-2H3,(H,25,26) |
| InChIKey | BDDMQYKKEYWGKO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate?
The IUPAC name of [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate (CID 6625176) is [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate.
What is the SMILES notation for [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate?
The canonical SMILES for [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate is Cc1ccc(C)c(NC(=O)c2nccnc2COC(=O)c2cccc(F)c2)c1.
What is the InChIKey of [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate?
The InChIKey is BDDMQYKKEYWGKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18FN3O3/c1-13-6-7-14(2)17(10-13)25-20(26)19-18(23-8-9-24-19)12-28-21(27)15-4-3-5-16(22)11-15/h3-11H,12H2,1-2H3,(H,25,26).
What are the key properties of [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate?
[3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate has a molecular weight of 379.39 g/mol, XLogP of 3.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,5-dimethylphenyl)carbamoyl]pyrazin-2-yl]methyl 3-fluorobenzoate is sourced from PubChem (CID 6625176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).