methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate

C16H15N3O2 — CID 6625231

IUPACmethyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate
SMILESCOC(=O)CNc1c(-c2ccccc2)nc2ccccn12
InChIInChI=1S/C16H15N3O2/c1-21-14(20)11-17-16-15(12-7-3-2-4-8-12)18-13-9-5-6-10-19(13)16/h2-10,17H,11H2,1H3
InChIKeyWMOSMBHMAXLAKB-UHFFFAOYSA-N
MW281.32 g/mol
LogP2.59
Rot. Bonds4

About methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate

methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate (PubChem CID 6625231) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate
PubChem CID6625231
Molecular FormulaC16H15N3O2
Molecular Weight281.32 g/mol
Exact Mass281.12
IUPAC Namemethyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate
SMILESCOC(=O)CNc1c(-c2ccccc2)nc2ccccn12
InChIInChI=1S/C16H15N3O2/c1-21-14(20)11-17-16-15(12-7-3-2-4-8-12)18-13-9-5-6-10-19(13)16/h2-10,17H,11H2,1H3
InChIKeyWMOSMBHMAXLAKB-UHFFFAOYSA-N
XLogP2.59
TPSA55.63 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.32
LogP ≤ 52.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate?
The IUPAC name of methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate (CID 6625231) is methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate.
What is the SMILES notation for methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate?
The canonical SMILES for methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate is COC(=O)CNc1c(-c2ccccc2)nc2ccccn12.
What is the InChIKey of methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate?
The InChIKey is WMOSMBHMAXLAKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O2/c1-21-14(20)11-17-16-15(12-7-3-2-4-8-12)18-13-9-5-6-10-19(13)16/h2-10,17H,11H2,1H3.
What are the key properties of methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate?
methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate has a molecular weight of 281.32 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]acetate is sourced from PubChem (CID 6625231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).