About 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine
4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine (PubChem CID 66253525) has the molecular formula C12H22N4O
and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine.
Molecular Properties
| Compound Name | 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine |
| PubChem CID | 66253525 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine |
| SMILES | CCCNC1COCC1c1nc(C(C)C)n[nH]1 |
| InChI | InChI=1S/C12H22N4O/c1-4-5-13-10-7-17-6-9(10)12-14-11(8(2)3)15-16-12/h8-10,13H,4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | IYYQDCGJLCAFSP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine?
The IUPAC name of 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine (CID 66253525) is 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine.
What is the SMILES notation for 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine?
The canonical SMILES for 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine is CCCNC1COCC1c1nc(C(C)C)n[nH]1.
What is the InChIKey of 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine?
The InChIKey is IYYQDCGJLCAFSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O/c1-4-5-13-10-7-17-6-9(10)12-14-11(8(2)3)15-16-12/h8-10,13H,4-7H2,1-3H3,(H,14,15,16).
What are the key properties of 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine?
4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine has a molecular weight of 238.33 g/mol, XLogP of 1.41, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)-N-propyloxolan-3-amine is sourced from PubChem (CID 66253525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).