C12H19NO3 — CID 66253813
4-[but-3-ynyl(propyl)amino]oxolane-3-carboxylic acid (PubChem CID 66253813) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-[but-3-ynyl(propyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[but-3-ynyl(propyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66253813 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 4-[but-3-ynyl(propyl)amino]oxolane-3-carboxylic acid |
| SMILES | C#CCCN(CCC)C1COCC1C(=O)O |
| InChI | InChI=1S/C12H19NO3/c1-3-5-7-13(6-4-2)11-9-16-8-10(11)12(14)15/h1,10-11H,4-9H2,2H3,(H,14,15) |
| InChIKey | NKPXAGZOCDNLFB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|