C17H15BrFN3 — CID 6625394
N-[[5-(4-bromophenyl)-1H-pyrazol-4-yl]methyl]-1-(3-fluorophenyl)methanamine (PubChem CID 6625394) has the molecular formula C17H15BrFN3 and a molecular weight of 360.23 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)-1H-pyrazol-4-yl]methyl]-1-(3-fluorophenyl)methanamine.
| Compound Name | N-[[5-(4-bromophenyl)-1H-pyrazol-4-yl]methyl]-1-(3-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 6625394 |
| Molecular Formula | C17H15BrFN3 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-[[5-(4-bromophenyl)-1H-pyrazol-4-yl]methyl]-1-(3-fluorophenyl)methanamine |
| SMILES | Fc1cccc(CNCc2cn[nH]c2-c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H15BrFN3/c18-15-6-4-13(5-7-15)17-14(11-21-22-17)10-20-9-12-2-1-3-16(19)8-12/h1-8,11,20H,9-10H2,(H,21,22) |
| InChIKey | MYMKEKHRGTWFKV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |