About 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole
4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole (PubChem CID 6625427) has the molecular formula C15H12N4OS2
and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole |
| PubChem CID | 6625427 |
| Molecular Formula | C15H12N4OS2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole |
| SMILES | Cc1oc(-c2cccs2)nc1CSc1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C15H12N4OS2/c1-9-12(17-14(20-9)13-3-2-6-21-13)8-22-15-18-10-4-5-16-7-11(10)19-15/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | GNJVXKJSCMIPDP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole?
The IUPAC name of 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole (CID 6625427) is 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole.
What is the SMILES notation for 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole?
The canonical SMILES for 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole is Cc1oc(-c2cccs2)nc1CSc1nc2ccncc2[nH]1.
What is the InChIKey of 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole?
The InChIKey is GNJVXKJSCMIPDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4OS2/c1-9-12(17-14(20-9)13-3-2-6-21-13)8-22-15-18-10-4-5-16-7-11(10)19-15/h2-7H,8H2,1H3,(H,18,19).
What are the key properties of 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole?
4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole has a molecular weight of 328.42 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole is sourced from PubChem (CID 6625427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).