C13H21N3O4 — CID 66254855
N-(2,6-dioxopiperidin-3-yl)-4-(propylamino)oxolane-3-carboxamide (PubChem CID 66254855) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-(propylamino)oxolane-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-(propylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66254855 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-(propylamino)oxolane-3-carboxamide |
| SMILES | CCCNC1COCC1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H21N3O4/c1-2-5-14-10-7-20-6-8(10)12(18)15-9-3-4-11(17)16-13(9)19/h8-10,14H,2-7H2,1H3,(H,15,18)(H,16,17,19) |
| InChIKey | SWNWIPOOQMKGSF-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|