About N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide
N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide (PubChem CID 6625603) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
| PubChem CID | 6625603 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCOc2ccccc21 |
| InChI | InChI=1S/C16H16N2O2/c19-16(17-12-13-6-2-1-3-7-13)18-10-11-20-15-9-5-4-8-14(15)18/h1-9H,10-12H2,(H,17,19) |
| InChIKey | PWHCZZLDJCYKRS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide?
The IUPAC name of N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide (CID 6625603) is N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide.
What is the SMILES notation for N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide?
The canonical SMILES for N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide is O=C(NCc1ccccc1)N1CCOc2ccccc21.
What is the InChIKey of N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide?
The InChIKey is PWHCZZLDJCYKRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c19-16(17-12-13-6-2-1-3-7-13)18-10-11-20-15-9-5-4-8-14(15)18/h1-9H,10-12H2,(H,17,19).
What are the key properties of N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide?
N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide has a molecular weight of 268.32 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide is sourced from PubChem (CID 6625603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).