C15H19N3OS2 — CID 662570
3,3-dimethyl-1-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butan-2-one (PubChem CID 662570) has the molecular formula C15H19N3OS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butan-2-one |
|---|---|
| PubChem CID | 662570 |
| Molecular Formula | C15H19N3OS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3,3-dimethyl-1-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butan-2-one |
| SMILES | C=CCn1c(SCC(=O)C(C)(C)C)nnc1-c1cccs1 |
| InChI | InChI=1S/C15H19N3OS2/c1-5-8-18-13(11-7-6-9-20-11)16-17-14(18)21-10-12(19)15(2,3)4/h5-7,9H,1,8,10H2,2-4H3 |
| InChIKey | OJLJEBJISLMZNM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|