About 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine
1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine (PubChem CID 662571) has the molecular formula C7H10N8
and a molecular weight of 206.21 g/mol. Its IUPAC name is 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine.
Molecular Properties
| Compound Name | 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine |
| PubChem CID | 662571 |
| Molecular Formula | C7H10N8 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine |
| SMILES | Cc1nn(C)cc1C=Nn1nnnc1N |
| InChI | InChI=1S/C7H10N8/c1-5-6(4-14(2)11-5)3-9-15-7(8)10-12-13-15/h3-4H,1-2H3,(H2,8,10,13) |
| InChIKey | GARPYAXHSOTQLG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine?
The IUPAC name of 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine (CID 662571) is 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine.
What is the SMILES notation for 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine?
The canonical SMILES for 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine is Cc1nn(C)cc1C=Nn1nnnc1N.
What is the InChIKey of 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine?
The InChIKey is GARPYAXHSOTQLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N8/c1-5-6(4-14(2)11-5)3-9-15-7(8)10-12-13-15/h3-4H,1-2H3,(H2,8,10,13).
What are the key properties of 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine?
1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine has a molecular weight of 206.21 g/mol, XLogP of -0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine is sourced from PubChem (CID 662571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).