C11H19F3N2O2 — CID 66257134
4-(propylamino)-N-(3,3,3-trifluoropropyl)oxolane-3-carboxamide (PubChem CID 66257134) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-(propylamino)-N-(3,3,3-trifluoropropyl)oxolane-3-carboxamide.
| Compound Name | 4-(propylamino)-N-(3,3,3-trifluoropropyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66257134 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-(propylamino)-N-(3,3,3-trifluoropropyl)oxolane-3-carboxamide |
| SMILES | CCCNC1COCC1C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O2/c1-2-4-15-9-7-18-6-8(9)10(17)16-5-3-11(12,13)14/h8-9,15H,2-7H2,1H3,(H,16,17) |
| InChIKey | BAKJJMPVXMDOPJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |