methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate

C11H18N2O4S — CID 6625744

IUPACmethyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate
SMILESCOC(=O)c1cc(S(=O)(=O)NC(C)(C)C)cn1C
InChIInChI=1S/C11H18N2O4S/c1-11(2,3)12-18(15,16)8-6-9(10(14)17-5)13(4)7-8/h6-7,12H,1-5H3
InChIKeyDNYWOALGUYQWOL-UHFFFAOYSA-N
MW274.34 g/mol
LogP0.89
Rot. Bonds3

About methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate

methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate (PubChem CID 6625744) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate
PubChem CID6625744
Molecular FormulaC11H18N2O4S
Molecular Weight274.34 g/mol
Exact Mass274.10
IUPAC Namemethyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate
SMILESCOC(=O)c1cc(S(=O)(=O)NC(C)(C)C)cn1C
InChIInChI=1S/C11H18N2O4S/c1-11(2,3)12-18(15,16)8-6-9(10(14)17-5)13(4)7-8/h6-7,12H,1-5H3
InChIKeyDNYWOALGUYQWOL-UHFFFAOYSA-N
XLogP0.89
TPSA77.40 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.34
LogP ≤ 50.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate?
The IUPAC name of methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate (CID 6625744) is methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate.
What is the SMILES notation for methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate?
The canonical SMILES for methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate is COC(=O)c1cc(S(=O)(=O)NC(C)(C)C)cn1C.
What is the InChIKey of methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate?
The InChIKey is DNYWOALGUYQWOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4S/c1-11(2,3)12-18(15,16)8-6-9(10(14)17-5)13(4)7-8/h6-7,12H,1-5H3.
What are the key properties of methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate?
methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate has a molecular weight of 274.34 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(tert-butylsulfamoyl)-1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 6625744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).