C17H11F2N3O3 — CID 6625806
1-(4H-chromeno[3,4-d][1,2]oxazol-3-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 6625806) has the molecular formula C17H11F2N3O3 and a molecular weight of 343.29 g/mol. Its IUPAC name is 1-(4H-chromeno[3,4-d][1,2]oxazol-3-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(4H-chromeno[3,4-d][1,2]oxazol-3-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 6625806 |
| Molecular Formula | C17H11F2N3O3 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-(4H-chromeno[3,4-d][1,2]oxazol-3-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)Nc1noc2c1COc1ccccc1-2 |
| InChI | InChI=1S/C17H11F2N3O3/c18-9-5-6-13(12(19)7-9)20-17(23)21-16-11-8-24-14-4-2-1-3-10(14)15(11)25-22-16/h1-7H,8H2,(H2,20,21,22,23) |
| InChIKey | JIOIZTPDHADRGU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |